CAS 174483-06-8 appears in our catalog under these names: Fexofenadine Impurity 9, Fexofenadine Impurity 30, Fexofenadine Impurity 10, m-Fexofenadine Ethyl Ester. Offered by: Chemat Brand, Hubei YoungXin, TRC. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg, 250mg.
Ethyl 2-[4-[1-hydroxy-4-[4-[hydroxy(diphenyl)methyl]piperidin-1-yl]butyl]phenyl]-2-methylpropanoate (CAS 174483-06-8) is a chemical compound with the molecular formula C34H43NO4 and a molecular weight of 529.7 g/mol. IUPAC name: ethyl 2-[4-[1-hydroxy-4-[4-[hydroxy(diphenyl)methyl]piperidin-1-yl]butyl]phenyl]-2-methylpropanoate. InChIKey: BKGNRWXKVMPQJE-UHFFFAOYSA-N.
| Molecular formula | C34H43NO4 |
|---|---|
| Molecular weight | 529.7 g/mol |
| IUPAC name | ethyl 2-[4-[1-hydroxy-4-[4-[hydroxy(diphenyl)methyl]piperidin-1-yl]butyl]phenyl]-2-methylpropanoate |
| InChIKey | BKGNRWXKVMPQJE-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(C)(C)C1=CC=C(C=C1)C(CCCN2CCC(CC2)C(C3=CC=CC=C3)(C4=CC=CC=C4)O)O |
Computed by PubChem (NCBI)