CAS 17451-66-0 is the registry number for N-Phthalimido 4-Nitro-L-phenylalanine. Offered by: TRC. Available pack sizes: 5g.
(2S)-2-(1,3-dioxoisoindol-2-yl)-3-(4-nitrophenyl)propanoic acid (CAS 17451-66-0) is a chemical compound with the molecular formula C17H12N2O6 and a molecular weight of 340.29 g/mol. IUPAC name: (2S)-2-(1,3-dioxoisoindol-2-yl)-3-(4-nitrophenyl)propanoic acid. InChIKey: HVFGSPHUECNWHF-AWEZNQCLSA-N.
| Molecular formula | C17H12N2O6 |
|---|---|
| Molecular weight | 340.29 g/mol |
| IUPAC name | (2S)-2-(1,3-dioxoisoindol-2-yl)-3-(4-nitrophenyl)propanoic acid |
| InChIKey | HVFGSPHUECNWHF-AWEZNQCLSA-N |
| SMILES | C1=CC=C2C(=C1)C(=O)N(C2=O)[C@@H](CC3=CC=C(C=C3)[N+](=O)[O-])C(=O)O |
Computed by PubChem (NCBI)