Products 174511-64-9
CAS 174511-64-9 appears in our catalog under these names: Ligstroside Aglycone, Ligustroside Aglycone. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 10mg.
Methyl (4S,5E,6R)-5-ethylidene-6-hydroxy-4-[2-[2-(4-hydroxyphenyl)ethoxy]-2-oxoethyl]-4H-pyran-3-carboxylate (CAS 174511-64-9) is a chemical compound with the molecular formula C19H22O7 and a molecular weight of 362.4 g/mol. IUPAC name: methyl (4S,5E,6R)-5-ethylidene-6-hydroxy-4-[2-[2-(4-hydroxyphenyl)ethoxy]-2-oxoethyl]-4H-pyran-3-carboxylate. InChIKey: ZJRZKUMVZLKDPM-HARHXEFRSA-N.
| Molecular formula | C19H22O7 |
|---|---|
| Molecular weight | 362.4 g/mol |
| IUPAC name | methyl (4S,5E,6R)-5-ethylidene-6-hydroxy-4-[2-[2-(4-hydroxyphenyl)ethoxy]-2-oxoethyl]-4H-pyran-3-carboxylate |
| InChIKey | ZJRZKUMVZLKDPM-HARHXEFRSA-N |
| SMILES | C/C=C/1\[C@@H](C(=CO[C@H]1O)C(=O)OC)CC(=O)OCCC2=CC=C(C=C2)O |
Computed by PubChem (NCBI)