Products 174561-03-6

CAS 174561-03-6 is the registry number for Methyl [1-(4-fluorobenzyl)piperidin-4-yl]acetate hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.

Structural formula: {0} (CAS {1})

Methyl 2-[1-[(4-fluorophenyl)methyl]piperidin-4-yl]acetate (CAS 174561-03-6) is a chemical compound with the molecular formula C15H20FNO2 and a molecular weight of 265.32 g/mol. IUPAC name: methyl 2-[1-[(4-fluorophenyl)methyl]piperidin-4-yl]acetate. InChIKey: MCYMLVGEGRTIIW-UHFFFAOYSA-N.

Identity
Molecular formulaC15H20FNO2
Molecular weight265.32 g/mol
IUPAC namemethyl 2-[1-[(4-fluorophenyl)methyl]piperidin-4-yl]acetate
InChIKeyMCYMLVGEGRTIIW-UHFFFAOYSA-N
SMILESCOC(=O)CC1CCN(CC1)CC2=CC=C(C=C2)F

Computed by PubChem (NCBI)