CAS 174653-61-3 is the registry number for Fmoc-L-Lys(pNZ)-OH. Offered by: Iris Biotech. Available pack sizes: 500mg, 1g, 5g, 25g.
(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-6-[(4-nitrophenyl)methoxycarbonylamino]hexanoic acid (CAS 174653-61-3) is a chemical compound with the molecular formula C29H29N3O8 and a molecular weight of 547.6 g/mol. IUPAC name: (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-6-[(4-nitrophenyl)methoxycarbonylamino]hexanoic acid. InChIKey: DJXVTKRIIBSAJY-SANMLTNESA-N.
| Molecular formula | C29H29N3O8 |
|---|---|
| Molecular weight | 547.6 g/mol |
| IUPAC name | (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-6-[(4-nitrophenyl)methoxycarbonylamino]hexanoic acid |
| InChIKey | DJXVTKRIIBSAJY-SANMLTNESA-N |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)N[C@@H](CCCCNC(=O)OCC4=CC=C(C=C4)[N+](=O)[O-])C(=O)O |
Computed by PubChem (NCBI)