CAS 1747-50-8 appears in our catalog under these names: 4-Methyl-n-(4-nitrobenzylidene)benzenesulfonohydrazide, 95%, 4–Methyl–N'–(4–nitrobenzylidene)benzenesulfonohydrazide. Offered by: Combi-blocks, GLPBio. Available pack sizes: 250mg, 1g, 100mg.
4-methyl-N-[(E)-(4-nitrophenyl)methylideneamino]benzenesulfonamide (CAS 1747-50-8) is a chemical compound with the molecular formula C14H13N3O4S and a molecular weight of 319.34 g/mol. IUPAC name: 4-methyl-N-[(E)-(4-nitrophenyl)methylideneamino]benzenesulfonamide. InChIKey: WIZQIGJXWBUJMH-XNTDXEJSSA-N.
| Molecular formula | C14H13N3O4S |
|---|---|
| Molecular weight | 319.34 g/mol |
| IUPAC name | 4-methyl-N-[(E)-(4-nitrophenyl)methylideneamino]benzenesulfonamide |
| InChIKey | WIZQIGJXWBUJMH-XNTDXEJSSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)N/N=C/C2=CC=C(C=C2)[N+](=O)[O-] |
Computed by PubChem (NCBI)