Products 174785-97-8
CAS 174785-97-8 is the registry number for Dimethyl-L-leucine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(2S)-2-(dimethylamino)-4-methylpentanoic acid (CAS 174785-97-8) is a chemical compound with the molecular formula C8H17NO2 and a molecular weight of 159.23 g/mol. IUPAC name: (2S)-2-(dimethylamino)-4-methylpentanoic acid. InChIKey: FZLYRJBAUQHHIH-ZETCQYMHSA-N.
| Molecular formula | C8H17NO2 |
|---|---|
| Molecular weight | 159.23 g/mol |
| IUPAC name | (2S)-2-(dimethylamino)-4-methylpentanoic acid |
| InChIKey | FZLYRJBAUQHHIH-ZETCQYMHSA-N |
| SMILES | CC(C)C[C@@H](C(=O)O)N(C)C |
Computed by PubChem (NCBI)
Synonyms:
(2S)-2-(dimethylamino)-4-methylpentanoic acid, N,N-Dimethyl-l-leucine, L-Leucine, N,N-dimethyl-, (S)-2-(Dimethylamino)-4-methylpentanoic acid, Dimethyl-L-leucine, N,N-Dimethyl-L-leucine HCl, n,n-dimethyl leucine, N-dimethyl-l-leucine, (S)-2-(Dimethylamino)-4-methylpentanoicacid, (S)-2-dimethylamino-4-methyl-pentanoic acid