CAS 174838-38-1 appears in our catalog under these names: 5'–Deoxy–5'–methylthioadenosine–d3, 5'-Methylthioadenosine-d3, 99.90%. Offered by: GLPBio, MedChemExpress. Available pack sizes: 1mg, 5mg, 5 mg, 1 mg.
(2R,3R,4S,5S)-2-(6-aminopurin-9-yl)-5-(trideuteriomethylsulfanylmethyl)oxolane-3,4-diol (CAS 174838-38-1) is a chemical compound with the molecular formula C11H15N5O3S and a molecular weight of 300.35 g/mol. IUPAC name: (2R,3R,4S,5S)-2-(6-aminopurin-9-yl)-5-(trideuteriomethylsulfanylmethyl)oxolane-3,4-diol. InChIKey: WUUGFSXJNOTRMR-YZLHILBGSA-N.
| Molecular formula | C11H15N5O3S |
|---|---|
| Molecular weight | 300.35 g/mol |
| IUPAC name | (2R,3R,4S,5S)-2-(6-aminopurin-9-yl)-5-(trideuteriomethylsulfanylmethyl)oxolane-3,4-diol |
| InChIKey | WUUGFSXJNOTRMR-YZLHILBGSA-N |
| SMILES | [2H]C([2H])([2H])SC[C@@H]1[C@H]([C@H]([C@@H](O1)N2C=NC3=C(N=CN=C32)N)O)O |
Computed by PubChem (NCBI)