CAS 17488-50-5 is the registry number for Atropin-7′-ol. Offered by: TRC. Available pack sizes: 25mg.
[(1S,5R)-8-methyl-8-azabicyclo[3.2.1]octan-3-yl] 2,3-dihydroxy-2-phenylpropanoate (CAS 17488-50-5) is a chemical compound with the molecular formula C17H23NO4 and a molecular weight of 305.4 g/mol. IUPAC name: [(1S,5R)-8-methyl-8-azabicyclo[3.2.1]octan-3-yl] 2,3-dihydroxy-2-phenylpropanoate. InChIKey: LNAGCMLWANGVDE-KWOWKCNFSA-N.
| Molecular formula | C17H23NO4 |
|---|---|
| Molecular weight | 305.4 g/mol |
| IUPAC name | [(1S,5R)-8-methyl-8-azabicyclo[3.2.1]octan-3-yl] 2,3-dihydroxy-2-phenylpropanoate |
| InChIKey | LNAGCMLWANGVDE-KWOWKCNFSA-N |
| SMILES | CN1[C@@H]2CC[C@H]1CC(C2)OC(=O)C(CO)(C3=CC=CC=C3)O |
Computed by PubChem (NCBI)