CAS 174899-93-5 is the registry number for 1,3-Dimethyl-1H-imidazol-3-ium 2,2,2-trifluoroacetate, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
1,3-dimethylimidazol-1-ium;2,2,2-trifluoroacetate (CAS 174899-93-5) is a chemical compound with the molecular formula C7H9F3N2O2 and a molecular weight of 210.15 g/mol. IUPAC name: 1,3-dimethylimidazol-1-ium;2,2,2-trifluoroacetate. InChIKey: ZAVHZTZIYKNTQV-UHFFFAOYSA-M.
| Molecular formula | C7H9F3N2O2 |
|---|---|
| Molecular weight | 210.15 g/mol |
| IUPAC name | 1,3-dimethylimidazol-1-ium;2,2,2-trifluoroacetate |
| InChIKey | ZAVHZTZIYKNTQV-UHFFFAOYSA-M |
| SMILES | CN1C=C[N+](=C1)C.C(=O)(C(F)(F)F)[O-] |
Computed by PubChem (NCBI)