CAS 1749-92-4 appears in our catalog under these names: Nitrofurantoin Impurity 5, Nitrofurantoin Impurity 3. Offered by: Chemat Brand. Available pack sizes: on request.
Acetic acid;1-[(E)-(5-nitrofuran-2-yl)methylideneamino]imidazolidine-2,4-dione (CAS 1749-92-4) is a chemical compound with the molecular formula C10H10N4O7 and a molecular weight of 298.21 g/mol. IUPAC name: acetic acid;1-[(E)-(5-nitrofuran-2-yl)methylideneamino]imidazolidine-2,4-dione. InChIKey: UMCASJWXQFBOPZ-JSGFVSQVSA-N.
| Molecular formula | C10H10N4O7 |
|---|---|
| Molecular weight | 298.21 g/mol |
| IUPAC name | acetic acid;1-[(E)-(5-nitrofuran-2-yl)methylideneamino]imidazolidine-2,4-dione |
| InChIKey | UMCASJWXQFBOPZ-JSGFVSQVSA-N |
| SMILES | CC(=O)O.C1C(=O)NC(=O)N1/N=C/C2=CC=C(O2)[N+](=O)[O-] |
Computed by PubChem (NCBI)