CAS 174913-62-3 is the registry number for 1,5-Dibromo-2,4-dichloro-3-methoxybenzene, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
1,5-dibromo-2,4-dichloro-3-methoxybenzene (CAS 174913-62-3) is a chemical compound with the molecular formula C7H4Br2Cl2O and a molecular weight of 334.82 g/mol. IUPAC name: 1,5-dibromo-2,4-dichloro-3-methoxybenzene. InChIKey: ZVMHUQHRJOJJDK-UHFFFAOYSA-N.
| Molecular formula | C7H4Br2Cl2O |
|---|---|
| Molecular weight | 334.82 g/mol |
| IUPAC name | 1,5-dibromo-2,4-dichloro-3-methoxybenzene |
| InChIKey | ZVMHUQHRJOJJDK-UHFFFAOYSA-N |
| SMILES | COC1=C(C(=CC(=C1Cl)Br)Br)Cl |
Computed by PubChem (NCBI)