CAS 174913-73-6 is the registry number for 1,2,5-Tribromo-4-chloro-3-methoxybenzene, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
1,2,5-tribromo-4-chloro-3-methoxybenzene (CAS 174913-73-6) is a chemical compound with the molecular formula C7H4Br3ClO and a molecular weight of 379.27 g/mol. IUPAC name: 1,2,5-tribromo-4-chloro-3-methoxybenzene. InChIKey: OXXCWBICQGLYTN-UHFFFAOYSA-N.
| Molecular formula | C7H4Br3ClO |
|---|---|
| Molecular weight | 379.27 g/mol |
| IUPAC name | 1,2,5-tribromo-4-chloro-3-methoxybenzene |
| InChIKey | OXXCWBICQGLYTN-UHFFFAOYSA-N |
| SMILES | COC1=C(C(=CC(=C1Br)Br)Br)Cl |
Computed by PubChem (NCBI)