Products 175087-64-6
CAS 175087-64-6 is the registry number for (2S,3R)-2-Amino-3-(tert-butoxy)-N-methylbutanamide. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
(2S,3R)-2-amino-N-methyl-3-[(2-methylpropan-2-yl)oxy]butanamide (CAS 175087-64-6) is a chemical compound with the molecular formula C9H20N2O2 and a molecular weight of 188.27 g/mol. IUPAC name: (2S,3R)-2-amino-N-methyl-3-[(2-methylpropan-2-yl)oxy]butanamide. InChIKey: DTMYXDSQCWRMQY-RQJHMYQMSA-N.
| Molecular formula | C9H20N2O2 |
|---|---|
| Molecular weight | 188.27 g/mol |
| IUPAC name | (2S,3R)-2-amino-N-methyl-3-[(2-methylpropan-2-yl)oxy]butanamide |
| InChIKey | DTMYXDSQCWRMQY-RQJHMYQMSA-N |
| SMILES | C[C@H]([C@@H](C(=O)NC)N)OC(C)(C)C |
Computed by PubChem (NCBI)