CAS 17510-46-2 is the registry number for (1-tert-butylvinyloxy)trimethylsilane, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g, 250mg.
3,3-dimethylbut-1-en-2-yloxy(trimethyl)silane (CAS 17510-46-2) is a chemical compound with the molecular formula C9H20OSi and a molecular weight of 172.34 g/mol. IUPAC name: 3,3-dimethylbut-1-en-2-yloxy(trimethyl)silane. InChIKey: PEHJULPJEVIIFJ-UHFFFAOYSA-N.
| Molecular formula | C9H20OSi |
|---|---|
| Molecular weight | 172.34 g/mol |
| IUPAC name | 3,3-dimethylbut-1-en-2-yloxy(trimethyl)silane |
| InChIKey | PEHJULPJEVIIFJ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C(=C)O[Si](C)(C)C |
Computed by PubChem (NCBI)