CAS 175131-60-9 appears in our catalog under these names: L-Milnacipran HCl, (1S-cis)-Milnacipran Hydrochloride, Levomilnacipran (hydrochloride), Milnacipran ((1S-cis) hydrochloride)/ 99.3% (existing batch purity), Levomilnacipran Hydrochloride, 98%, 98%. Offered by: Chemat Brand, TRC, GLPBio, TargetMol, Chemat. Available pack sizes: on request, 500mg, 100mg, 25mg, 10mM (in 1ml water), 50mg, 5mg, 10mg.
Cis-(1S,2R)-2-(aminomethyl)-N,N-diethyl-1-phenylcyclopropane-1-carboxamide;hydrochloride (CAS 175131-60-9) is a chemical compound with the molecular formula C15H23ClN2O and a molecular weight of 282.81 g/mol. IUPAC name: cis-(1S,2R)-2-(aminomethyl)-N,N-diethyl-1-phenylcyclopropane-1-carboxamide;hydrochloride. InChIKey: XNCDYJFPRPDERF-NQQJLSKUSA-N.
| Molecular formula | C15H23ClN2O |
|---|---|
| Molecular weight | 282.81 g/mol |
| IUPAC name | cis-(1S,2R)-2-(aminomethyl)-N,N-diethyl-1-phenylcyclopropane-1-carboxamide;hydrochloride |
| InChIKey | XNCDYJFPRPDERF-NQQJLSKUSA-N |
| SMILES | CCN(CC)C(=O)[C@]1(C[C@H]1CN)C2=CC=CC=C2.Cl |
Computed by PubChem (NCBI)