CAS 175136-40-0 is the registry number for (7-Bromo-2,3-dihydrobenzo[b][1,4]dioxin-6-yl)(4-bromophenyl)methanone, 95+%. Offered by: Chemat Brand. Available pack sizes: on request.
(6-bromo-2,3-dihydro-1,4-benzodioxin-7-yl)-(4-bromophenyl)methanone (CAS 175136-40-0) is a chemical compound with the molecular formula C15H10Br2O3 and a molecular weight of 398.04 g/mol. IUPAC name: (6-bromo-2,3-dihydro-1,4-benzodioxin-7-yl)-(4-bromophenyl)methanone. InChIKey: LDEWYYUQJRXQRI-UHFFFAOYSA-N.
| Molecular formula | C15H10Br2O3 |
|---|---|
| Molecular weight | 398.04 g/mol |
| IUPAC name | (6-bromo-2,3-dihydro-1,4-benzodioxin-7-yl)-(4-bromophenyl)methanone |
| InChIKey | LDEWYYUQJRXQRI-UHFFFAOYSA-N |
| SMILES | C1COC2=C(O1)C=C(C(=C2)Br)C(=O)C3=CC=C(C=C3)Br |
Computed by PubChem (NCBI)