CAS 175137-65-2 appears in our catalog under these names: 4-[(4-Chlorophenyl)sulfonyl]-3-methylthiophene-2-carboxylic acid, 97% , 4-(4-Chloro-benzenesulfonyl)-3-methyl-thiophene-2-carboxylic acid. Offered by: Thermo Scientific, Fluorochem. Available pack sizes: 1g, 10g, 500mg.
4-(4-chlorophenyl)sulfonyl-3-methylthiophene-2-carboxylic acid (CAS 175137-65-2) is a chemical compound with the molecular formula C12H9ClO4S2 and a molecular weight of 316.8 g/mol. IUPAC name: 4-(4-chlorophenyl)sulfonyl-3-methylthiophene-2-carboxylic acid. InChIKey: WZQQSJVPCVCQKE-UHFFFAOYSA-N.
| Molecular formula | C12H9ClO4S2 |
|---|---|
| Molecular weight | 316.8 g/mol |
| IUPAC name | 4-(4-chlorophenyl)sulfonyl-3-methylthiophene-2-carboxylic acid |
| InChIKey | WZQQSJVPCVCQKE-UHFFFAOYSA-N |
| SMILES | CC1=C(SC=C1S(=O)(=O)C2=CC=C(C=C2)Cl)C(=O)O |
Computed by PubChem (NCBI)