CAS 175137-68-5 is the registry number for 2-(4,5-Dichloro-1H-imidazol-1-yl)acetohydrazide, 95+%. Offered by: Chemat Brand. Available pack sizes: on request.
2-(4,5-dichloroimidazol-1-yl)acetohydrazide (CAS 175137-68-5) is a chemical compound with the molecular formula C5H6Cl2N4O and a molecular weight of 209.03 g/mol. IUPAC name: 2-(4,5-dichloroimidazol-1-yl)acetohydrazide. InChIKey: RZLSBIKQOCNNMQ-UHFFFAOYSA-N.
| Molecular formula | C5H6Cl2N4O |
|---|---|
| Molecular weight | 209.03 g/mol |
| IUPAC name | 2-(4,5-dichloroimidazol-1-yl)acetohydrazide |
| InChIKey | RZLSBIKQOCNNMQ-UHFFFAOYSA-N |
| SMILES | C1=NC(=C(N1CC(=O)NN)Cl)Cl |
Computed by PubChem (NCBI)