CAS 175156-71-5 is the registry number for Cinidon (free acid) 100 µg/mL in Acetonitrile. Offered by: Dr. Ehrenstorfer. Available pack sizes: 1ml.
(Z)-2-chloro-3-[2-chloro-5-(1,3-dioxo-4,5,6,7-tetrahydroisoindol-2-yl)phenyl]prop-2-enoic acid (CAS 175156-71-5) is a chemical compound with the molecular formula C17H13Cl2NO4 and a molecular weight of 366.2 g/mol. IUPAC name: (Z)-2-chloro-3-[2-chloro-5-(1,3-dioxo-4,5,6,7-tetrahydroisoindol-2-yl)phenyl]prop-2-enoic acid. InChIKey: QTASTLGMYDHNTR-ZSOIEALJSA-N.
| Molecular formula | C17H13Cl2NO4 |
|---|---|
| Molecular weight | 366.2 g/mol |
| IUPAC name | (Z)-2-chloro-3-[2-chloro-5-(1,3-dioxo-4,5,6,7-tetrahydroisoindol-2-yl)phenyl]prop-2-enoic acid |
| InChIKey | QTASTLGMYDHNTR-ZSOIEALJSA-N |
| SMILES | C1CCC2=C(C1)C(=O)N(C2=O)C3=CC(=C(C=C3)Cl)/C=C(/C(=O)O)\Cl |
Computed by PubChem (NCBI)