CAS 175202-11-6 is the registry number for 5-(tert-Butylsulfonyl)-2-morpholinopyrimidin-4-amine, 97% . Offered by: Thermo Scientific. Available pack sizes: 1g.
5-tert-butylsulfonyl-2-morpholin-4-ylpyrimidin-4-amine (CAS 175202-11-6) is a chemical compound with the molecular formula C12H20N4O3S and a molecular weight of 300.38 g/mol. IUPAC name: 5-tert-butylsulfonyl-2-morpholin-4-ylpyrimidin-4-amine. InChIKey: GDHZZUDBHRLEQY-UHFFFAOYSA-N.
| Molecular formula | C12H20N4O3S |
|---|---|
| Molecular weight | 300.38 g/mol |
| IUPAC name | 5-tert-butylsulfonyl-2-morpholin-4-ylpyrimidin-4-amine |
| InChIKey | GDHZZUDBHRLEQY-UHFFFAOYSA-N |
| SMILES | CC(C)(C)S(=O)(=O)C1=CN=C(N=C1N)N2CCOCC2 |
Computed by PubChem (NCBI)