CAS 175203-45-9 is the registry number for Methyl 2-(Chlorosulfonyl)-3-methoxythiophene-4-carboxylate, 97%. Offered by: Fluorochem. Available pack sizes: 1g, 5g.
Methyl 5-chlorosulfonyl-4-methoxythiophene-3-carboxylate (CAS 175203-45-9) is a chemical compound with the molecular formula C7H7ClO5S2 and a molecular weight of 270.7 g/mol. IUPAC name: methyl 5-chlorosulfonyl-4-methoxythiophene-3-carboxylate. InChIKey: IJGCJDNTXHGTFB-UHFFFAOYSA-N.
| Molecular formula | C7H7ClO5S2 |
|---|---|
| Molecular weight | 270.7 g/mol |
| IUPAC name | methyl 5-chlorosulfonyl-4-methoxythiophene-3-carboxylate |
| InChIKey | IJGCJDNTXHGTFB-UHFFFAOYSA-N |
| SMILES | COC1=C(SC=C1C(=O)OC)S(=O)(=O)Cl |
Computed by PubChem (NCBI)