CAS 175203-50-6 appears in our catalog under these names: 2-([2-(Trifluoromethyl)-4-quinolyl]thio)ethylamine, 95%, 2-{[2-(Trifluoromethyl)-4-quinolyl]thio}ethylamine. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 5g, 10g, 1g.
2-[2-(trifluoromethyl)quinolin-4-yl]sulfanylethanamine (CAS 175203-50-6) is a chemical compound with the molecular formula C12H11F3N2S and a molecular weight of 272.29 g/mol. IUPAC name: 2-[2-(trifluoromethyl)quinolin-4-yl]sulfanylethanamine. InChIKey: SIVFTOISFTWFPU-UHFFFAOYSA-N.
| Molecular formula | C12H11F3N2S |
|---|---|
| Molecular weight | 272.29 g/mol |
| IUPAC name | 2-[2-(trifluoromethyl)quinolin-4-yl]sulfanylethanamine |
| InChIKey | SIVFTOISFTWFPU-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=CC(=N2)C(F)(F)F)SCCN |
Computed by PubChem (NCBI)