CAS 175203-94-8 appears in our catalog under these names: 5-Chloro-3-methylbenzo[b]thiophene-2-sulfonamide, 95%, 3-Chloro-5-methylbenzo(b)thiophene-2-sulfonamide, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 25g, 5g, 1g, 10g.
5-chloro-3-methyl-1-benzothiophene-2-sulfonamide (CAS 175203-94-8) is a chemical compound with the molecular formula C9H8ClNO2S2 and a molecular weight of 261.8 g/mol. IUPAC name: 5-chloro-3-methyl-1-benzothiophene-2-sulfonamide. InChIKey: CGMQMZKLIJYAKX-UHFFFAOYSA-N.
| Molecular formula | C9H8ClNO2S2 |
|---|---|
| Molecular weight | 261.8 g/mol |
| IUPAC name | 5-chloro-3-methyl-1-benzothiophene-2-sulfonamide |
| InChIKey | CGMQMZKLIJYAKX-UHFFFAOYSA-N |
| SMILES | CC1=C(SC2=C1C=C(C=C2)Cl)S(=O)(=O)N |
Computed by PubChem (NCBI)