CAS 175203-95-9 appears in our catalog under these names: 4,6-Dichlorobenzofuran 95%, 4,6–Dichlorobenzofuran. Offered by: Ambeed, GLPBio. Available pack sizes: 100mg, 250mg, 1g.
4,6-dichloro-1-benzofuran (CAS 175203-95-9) is a chemical compound with the molecular formula C8H4Cl2O and a molecular weight of 187.02 g/mol. IUPAC name: 4,6-dichloro-1-benzofuran. InChIKey: ZVYPNSGWLVPWSF-UHFFFAOYSA-N.
| Molecular formula | C8H4Cl2O |
|---|---|
| Molecular weight | 187.02 g/mol |
| IUPAC name | 4,6-dichloro-1-benzofuran |
| InChIKey | ZVYPNSGWLVPWSF-UHFFFAOYSA-N |
| SMILES | C1=COC2=C1C(=CC(=C2)Cl)Cl |
Computed by PubChem (NCBI)