CAS 175204-13-4 is the registry number for 2,6-Bis(2,2,2-trifluoroethoxy)-3-bromobenzonitrile, 95%. Offered by: Combi-blocks. Available pack sizes: 500mg.
3-bromo-2,6-bis(2,2,2-trifluoroethoxy)benzonitrile (CAS 175204-13-4) is a chemical compound with the molecular formula C11H6BrF6NO2 and a molecular weight of 378.06 g/mol. IUPAC name: 3-bromo-2,6-bis(2,2,2-trifluoroethoxy)benzonitrile. InChIKey: LMWGWGQYRSNKJZ-UHFFFAOYSA-N.
| Molecular formula | C11H6BrF6NO2 |
|---|---|
| Molecular weight | 378.06 g/mol |
| IUPAC name | 3-bromo-2,6-bis(2,2,2-trifluoroethoxy)benzonitrile |
| InChIKey | LMWGWGQYRSNKJZ-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1OCC(F)(F)F)C#N)OCC(F)(F)F)Br |
Computed by PubChem (NCBI)