CAS 175204-95-2 is the registry number for 6-Chloro-3-[4-(trifluoromethyl)phenyl][1,2,4]triazolo[4,3-b]pyridazine, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 1g, 5g, 250mg.
6-chloro-3-[4-(trifluoromethyl)phenyl]-[1,2,4]triazolo[4,3-b]pyridazine (CAS 175204-95-2) is a chemical compound with the molecular formula C12H6ClF3N4 and a molecular weight of 298.65 g/mol. IUPAC name: 6-chloro-3-[4-(trifluoromethyl)phenyl]-[1,2,4]triazolo[4,3-b]pyridazine. InChIKey: HTASUBNIRGUCTA-UHFFFAOYSA-N.
| Molecular formula | C12H6ClF3N4 |
|---|---|
| Molecular weight | 298.65 g/mol |
| IUPAC name | 6-chloro-3-[4-(trifluoromethyl)phenyl]-[1,2,4]triazolo[4,3-b]pyridazine |
| InChIKey | HTASUBNIRGUCTA-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=NN=C3N2N=C(C=C3)Cl)C(F)(F)F |
Computed by PubChem (NCBI)