CAS 175205-51-3 appears in our catalog under these names: 1-[3,5-Bis(trifluoromethyl)phenyl]-2,5-dimethyl-1h-pyrrole, 95%, 1-(3,5-Bis(trifluoromethyl)phenyl)-2,5-dimethyl-1H-pyrrole 97%, 1-(3,5-Bis(trifluoromethyl)phenyl)-2,5-dimethyl-1H-pyrrole, 97%, 97%. Offered by: Combi-blocks, Ambeed, Chemat. Available pack sizes: 25g, 1g, 5g.
1-[3,5-bis(trifluoromethyl)phenyl]-2,5-dimethylpyrrole (CAS 175205-51-3) is a chemical compound with the molecular formula C14H11F6N and a molecular weight of 307.23 g/mol. IUPAC name: 1-[3,5-bis(trifluoromethyl)phenyl]-2,5-dimethylpyrrole. InChIKey: KUDHKDYSHKOCTC-UHFFFAOYSA-N.
| Molecular formula | C14H11F6N |
|---|---|
| Molecular weight | 307.23 g/mol |
| IUPAC name | 1-[3,5-bis(trifluoromethyl)phenyl]-2,5-dimethylpyrrole |
| InChIKey | KUDHKDYSHKOCTC-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(N1C2=CC(=CC(=C2)C(F)(F)F)C(F)(F)F)C |
Computed by PubChem (NCBI)