Products 175277-51-7
CAS 175277-51-7 is the registry number for 5-(Trifluoromethyl)pyridine-2-thioamide, 95%. Offered by: Fluorochem. Available pack sizes: 1g, 5g.
5-(trifluoromethyl)pyridine-2-carbothioamide (CAS 175277-51-7) is a chemical compound with the molecular formula C7H5F3N2S and a molecular weight of 206.19 g/mol. IUPAC name: 5-(trifluoromethyl)pyridine-2-carbothioamide. InChIKey: ORSQVELABPHSGL-UHFFFAOYSA-N.
| Molecular formula | C7H5F3N2S |
|---|---|
| Molecular weight | 206.19 g/mol |
| IUPAC name | 5-(trifluoromethyl)pyridine-2-carbothioamide |
| InChIKey | ORSQVELABPHSGL-UHFFFAOYSA-N |
| SMILES | C1=CC(=NC=C1C(F)(F)F)C(=S)N |
Computed by PubChem (NCBI)