Products 175277-64-2
CAS 175277-64-2 appears in our catalog under these names: 1-(9H-Fluoren-9-yl)piperazine dihydrochloride, 95.0%, 1-(9H-Fluoren-9-yl)piperazine dihydrochloride, ≥95%. Offered by: Fluorochem, Chemat. Available pack sizes: 500mg, 250mg, 1g, 50mg, 5g.
1-(9H-fluoren-9-yl)piperazine;dihydrochloride (CAS 175277-64-2) is a chemical compound with the molecular formula C17H20Cl2N2 and a molecular weight of 323.3 g/mol. IUPAC name: 1-(9H-fluoren-9-yl)piperazine;dihydrochloride. InChIKey: SUASQIFMVLUTNH-UHFFFAOYSA-N.
| Molecular formula | C17H20Cl2N2 |
|---|---|
| Molecular weight | 323.3 g/mol |
| IUPAC name | 1-(9H-fluoren-9-yl)piperazine;dihydrochloride |
| InChIKey | SUASQIFMVLUTNH-UHFFFAOYSA-N |
| SMILES | C1CN(CCN1)C2C3=CC=CC=C3C4=CC=CC=C24.Cl.Cl |
Computed by PubChem (NCBI)