CAS 175283-25-7 is the registry number for 4-Ethynyl-2,3-difluorobenzonitrile, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
4-ethynyl-2,3-difluorobenzonitrile (CAS 175283-25-7) is a chemical compound with the molecular formula C9H3F2N and a molecular weight of 163.12 g/mol. IUPAC name: 4-ethynyl-2,3-difluorobenzonitrile. InChIKey: INVJUMHUIROYSF-UHFFFAOYSA-N.
| Molecular formula | C9H3F2N |
|---|---|
| Molecular weight | 163.12 g/mol |
| IUPAC name | 4-ethynyl-2,3-difluorobenzonitrile |
| InChIKey | INVJUMHUIROYSF-UHFFFAOYSA-N |
| SMILES | C#CC1=C(C(=C(C=C1)C#N)F)F |
Computed by PubChem (NCBI)