CAS 17534-14-4 is the registry number for 9-Anthracenethiol. Offered by: TRC. Available pack sizes: 50mg.
Anthracene-9-thiol (CAS 17534-14-4) is a chemical compound with the molecular formula C14H10S and a molecular weight of 210.30 g/mol. IUPAC name: anthracene-9-thiol. InChIKey: CTUXILQBEJGEAT-UHFFFAOYSA-N.
| Molecular formula | C14H10S |
|---|---|
| Molecular weight | 210.30 g/mol |
| IUPAC name | anthracene-9-thiol |
| InChIKey | CTUXILQBEJGEAT-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=C3C=CC=CC3=C2S |
Computed by PubChem (NCBI)