CAS 17553-89-8 appears in our catalog under these names: (R)-(-)-2,3,7,7A-Tetrahydro-7a-methyl-1h-indene-1,5(6h)-dione, 98%, (R)-7a-Methyl-2,3,7,7a-tetrahydro-1H-indene-1,5(6H)-dione, 98%, (R)–(–)–2,3,7,7a–Tetrahydro–7a–methyl–1H–indene–1,5(6H)–dione. Offered by: Combi-blocks, AmBeed, GLPBio. Available pack sizes: 1g, 250mg, 100mg.
(7aR)-7a-methyl-2,3,6,7-tetrahydroindene-1,5-dione (CAS 17553-89-8) is a chemical compound with the molecular formula C10H12O2 and a molecular weight of 164.20 g/mol. IUPAC name: (7aR)-7a-methyl-2,3,6,7-tetrahydroindene-1,5-dione. InChIKey: FNYAZSZTENLTRT-SNVBAGLBSA-N.
| Molecular formula | C10H12O2 |
|---|---|
| Molecular weight | 164.20 g/mol |
| IUPAC name | (7aR)-7a-methyl-2,3,6,7-tetrahydroindene-1,5-dione |
| InChIKey | FNYAZSZTENLTRT-SNVBAGLBSA-N |
| SMILES | C[C@@]12CCC(=O)C=C1CCC2=O |
Computed by PubChem (NCBI)