CAS 175591-17-0 is the registry number for O-Methyl Tapentadol Hydrochloride. Offered by: TRC, Biosynth. Available pack sizes: 500mg, 5000mg, 10000mg.
(2R,3R)-3-(3-methoxyphenyl)-N,N,2-trimethylpentan-1-amine;hydrochloride (CAS 175591-17-0) is a chemical compound with the molecular formula C15H26ClNO and a molecular weight of 271.82 g/mol. IUPAC name: (2R,3R)-3-(3-methoxyphenyl)-N,N,2-trimethylpentan-1-amine;hydrochloride. InChIKey: XKSJVTDZSYZBGF-SBKWZQTDSA-N.
| Molecular formula | C15H26ClNO |
|---|---|
| Molecular weight | 271.82 g/mol |
| IUPAC name | (2R,3R)-3-(3-methoxyphenyl)-N,N,2-trimethylpentan-1-amine;hydrochloride |
| InChIKey | XKSJVTDZSYZBGF-SBKWZQTDSA-N |
| SMILES | CC[C@@H](C1=CC(=CC=C1)OC)[C@@H](C)CN(C)C.Cl |
Computed by PubChem (NCBI)