CAS 175695-32-6 is the registry number for tert-Butyl 2-(2-amino-6-chloro-9H-purin-9-yl)acetate. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
Tert-butyl 2-(2-amino-6-chloropurin-9-yl)acetate (CAS 175695-32-6) is a chemical compound with the molecular formula C11H14ClN5O2 and a molecular weight of 283.71 g/mol. IUPAC name: tert-butyl 2-(2-amino-6-chloropurin-9-yl)acetate. InChIKey: ZRKRPDZEHCMYSH-UHFFFAOYSA-N.
| Molecular formula | C11H14ClN5O2 |
|---|---|
| Molecular weight | 283.71 g/mol |
| IUPAC name | tert-butyl 2-(2-amino-6-chloropurin-9-yl)acetate |
| InChIKey | ZRKRPDZEHCMYSH-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)CN1C=NC2=C1N=C(N=C2Cl)N |
Computed by PubChem (NCBI)