CAS 17570-76-2 appears in our catalog under these names: Lead(II) Methanesulfonate (50 wt. % in H20), Lead(II) methanesulfonate, LEAD(II) METHANESULFONATE, 50 WT. % &. Offered by: TRC, GLPBio, Sigma-Aldrich. Available pack sizes: 10ml, 25ml, 5ml, 1l, 250ml, 5l.
Lead(2+);methanesulfonate (CAS 17570-76-2) is a chemical compound with the molecular formula C2H6O6PbS2 and a molecular weight of 397 g/mol. IUPAC name: lead(2+);methanesulfonate. InChIKey: LLABTCPIBSAMGS-UHFFFAOYSA-L.
| Molecular formula | C2H6O6PbS2 |
|---|---|
| Molecular weight | 397 g/mol |
| IUPAC name | lead(2+);methanesulfonate |
| InChIKey | LLABTCPIBSAMGS-UHFFFAOYSA-L |
| SMILES | CS(=O)(=O)[O-].CS(=O)(=O)[O-].[Pb+2] |
Computed by PubChem (NCBI)