Products 175711-73-6

CAS 175711-73-6 is the registry number for Methyl 4-(2,4-dichlorophenyl)-2,4-dioxobutanoate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.

Structural formula: {0} (CAS {1})

Methyl 4-(2,4-dichlorophenyl)-2,4-dioxobutanoate (CAS 175711-73-6) is a chemical compound with the molecular formula C11H8Cl2O4 and a molecular weight of 275.08 g/mol. IUPAC name: methyl 4-(2,4-dichlorophenyl)-2,4-dioxobutanoate. InChIKey: AANFKOMMZYTNJZ-UHFFFAOYSA-N.

Identity
Molecular formulaC11H8Cl2O4
Molecular weight275.08 g/mol
IUPAC namemethyl 4-(2,4-dichlorophenyl)-2,4-dioxobutanoate
InChIKeyAANFKOMMZYTNJZ-UHFFFAOYSA-N
SMILESCOC(=O)C(=O)CC(=O)C1=C(C=C(C=C1)Cl)Cl

Computed by PubChem (NCBI)