CAS 175711-73-6 is the registry number for Methyl 4-(2,4-dichlorophenyl)-2,4-dioxobutanoate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
Methyl 4-(2,4-dichlorophenyl)-2,4-dioxobutanoate (CAS 175711-73-6) is a chemical compound with the molecular formula C11H8Cl2O4 and a molecular weight of 275.08 g/mol. IUPAC name: methyl 4-(2,4-dichlorophenyl)-2,4-dioxobutanoate. InChIKey: AANFKOMMZYTNJZ-UHFFFAOYSA-N.
| Molecular formula | C11H8Cl2O4 |
|---|---|
| Molecular weight | 275.08 g/mol |
| IUPAC name | methyl 4-(2,4-dichlorophenyl)-2,4-dioxobutanoate |
| InChIKey | AANFKOMMZYTNJZ-UHFFFAOYSA-N |
| SMILES | COC(=O)C(=O)CC(=O)C1=C(C=C(C=C1)Cl)Cl |
Computed by PubChem (NCBI)