Products 17576-86-2

CAS 17576-86-2 is the registry number for N-(2-bromophenyl)-N-methylnitrous amide. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

N-(2-bromophenyl)-N-methylnitrous amide (CAS 17576-86-2) is a chemical compound with the molecular formula C7H7BrN2O and a molecular weight of 215.05 g/mol. IUPAC name: N-(2-bromophenyl)-N-methylnitrous amide. InChIKey: IZGCCPNMZRXRJN-UHFFFAOYSA-N.

Identity
Molecular formulaC7H7BrN2O
Molecular weight215.05 g/mol
IUPAC nameN-(2-bromophenyl)-N-methylnitrous amide
InChIKeyIZGCCPNMZRXRJN-UHFFFAOYSA-N
SMILESCN(C1=CC=CC=C1Br)N=O

Computed by PubChem (NCBI)