Products 175776-12-2

CAS 175776-12-2 is the registry number for (1R,2S)-2-Fluorocyclopropan-1-amine 2,2,2-trifluoroacetate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

Cis-(1R,2S)-2-fluorocyclopropan-1-amine;2,2,2-trifluoroacetic acid (CAS 175776-12-2) is a chemical compound with the molecular formula C5H7F4NO2 and a molecular weight of 189.11 g/mol. IUPAC name: cis-(1R,2S)-2-fluorocyclopropan-1-amine;2,2,2-trifluoroacetic acid. InChIKey: LOQQXLJVWHCORE-LJUKVTEVSA-N.

Identity
Molecular formulaC5H7F4NO2
Molecular weight189.11 g/mol
IUPAC namecis-(1R,2S)-2-fluorocyclopropan-1-amine;2,2,2-trifluoroacetic acid
InChIKeyLOQQXLJVWHCORE-LJUKVTEVSA-N
SMILESC1[C@H]([C@H]1F)N.C(=O)(C(F)(F)F)O

Computed by PubChem (NCBI)