Products 17579-92-9
CAS 17579-92-9 is the registry number for 2-Benzoyl-3-methylnapthalene-1,4-dione, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 250mg, 500mg, 1g, 2,5g, 5g, 10g.
2-benzoyl-3-methylnaphthalene-1,4-dione (CAS 17579-92-9) is a chemical compound with the molecular formula C18H12O3 and a molecular weight of 276.3 g/mol. IUPAC name: 2-benzoyl-3-methylnaphthalene-1,4-dione. InChIKey: OCZKQMYLTCURCE-UHFFFAOYSA-N.
| Molecular formula | C18H12O3 |
|---|---|
| Molecular weight | 276.3 g/mol |
| IUPAC name | 2-benzoyl-3-methylnaphthalene-1,4-dione |
| InChIKey | OCZKQMYLTCURCE-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=O)C2=CC=CC=C2C1=O)C(=O)C3=CC=CC=C3 |
Computed by PubChem (NCBI)