CAS 175844-54-9 is the registry number for Pinaverium Bromide Impurity 18. Offered by: Chemat Brand. Available pack sizes: on request.
1-bromo-2-(bromomethyl)-3,4-dimethoxybenzene (CAS 175844-54-9) is a chemical compound with the molecular formula C9H10Br2O2 and a molecular weight of 309.98 g/mol. IUPAC name: 1-bromo-2-(bromomethyl)-3,4-dimethoxybenzene. InChIKey: AJAYESVYITWCMY-UHFFFAOYSA-N.
| Molecular formula | C9H10Br2O2 |
|---|---|
| Molecular weight | 309.98 g/mol |
| IUPAC name | 1-bromo-2-(bromomethyl)-3,4-dimethoxybenzene |
| InChIKey | AJAYESVYITWCMY-UHFFFAOYSA-N |
| SMILES | COC1=C(C(=C(C=C1)Br)CBr)OC |
Computed by PubChem (NCBI)