Products 175844-54-9

CAS 175844-54-9 is the registry number for Pinaverium Bromide Impurity 18. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

1-bromo-2-(bromomethyl)-3,4-dimethoxybenzene (CAS 175844-54-9) is a chemical compound with the molecular formula C9H10Br2O2 and a molecular weight of 309.98 g/mol. IUPAC name: 1-bromo-2-(bromomethyl)-3,4-dimethoxybenzene. InChIKey: AJAYESVYITWCMY-UHFFFAOYSA-N.

Identity
Molecular formulaC9H10Br2O2
Molecular weight309.98 g/mol
IUPAC name1-bromo-2-(bromomethyl)-3,4-dimethoxybenzene
InChIKeyAJAYESVYITWCMY-UHFFFAOYSA-N
SMILESCOC1=C(C(=C(C=C1)Br)CBr)OC

Computed by PubChem (NCBI)