CAS 175845-69-9 is the registry number for Glucose Impurity 4. Offered by: Chemat Brand. Available pack sizes: on request.
2-[bis[[(2R,3S,4R,5R)-2,3,4,5-tetrahydroxyoxan-2-yl]methyl]amino]acetic acid (CAS 175845-69-9) is a chemical compound with the molecular formula C14H25NO12 and a molecular weight of 399.35 g/mol. IUPAC name: 2-[bis[[(2R,3S,4R,5R)-2,3,4,5-tetrahydroxyoxan-2-yl]methyl]amino]acetic acid. InChIKey: PWBSVUZOLJLXOI-GUKSMMDYSA-N.
| Molecular formula | C14H25NO12 |
|---|---|
| Molecular weight | 399.35 g/mol |
| IUPAC name | 2-[bis[[(2R,3S,4R,5R)-2,3,4,5-tetrahydroxyoxan-2-yl]methyl]amino]acetic acid |
| InChIKey | PWBSVUZOLJLXOI-GUKSMMDYSA-N |
| SMILES | C1[C@H]([C@H]([C@@H]([C@](O1)(CN(CC(=O)O)C[C@@]2([C@H]([C@@H]([C@@H](CO2)O)O)O)O)O)O)O)O |
Computed by PubChem (NCBI)