CAS 175870-21-0 appears in our catalog under these names: Silodosin Dehydro Impurity, Silodosin Impurity 4, Silodosin Impurity 5, Dehydro Silodosin, >95% (HPLC), 1-(3-Hydroxypropyl)-5-[(2R)-2-[[2-[2-(2,2,2-trifluoroethoxy)phenoxy]ethyl]amino]propyl]-1H-indole-7-carboxamide, 95%, 95%. Offered by: Chemat Brand, Hubei YoungXin, TRC, Chemat, MedChemExpress. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg, 10 mg, 100 mg.
1-(3-hydroxypropyl)-5-[(2R)-2-[2-[2-(2,2,2-trifluoroethoxy)phenoxy]ethylamino]propyl]indole-7-carboxamide (CAS 175870-21-0) is a chemical compound with the molecular formula C25H30F3N3O4 and a molecular weight of 493.5 g/mol. IUPAC name: 1-(3-hydroxypropyl)-5-[(2R)-2-[2-[2-(2,2,2-trifluoroethoxy)phenoxy]ethylamino]propyl]indole-7-carboxamide. InChIKey: VICSLOHTZDWOFF-QGZVFWFLSA-N.
| Molecular formula | C25H30F3N3O4 |
|---|---|
| Molecular weight | 493.5 g/mol |
| IUPAC name | 1-(3-hydroxypropyl)-5-[(2R)-2-[2-[2-(2,2,2-trifluoroethoxy)phenoxy]ethylamino]propyl]indole-7-carboxamide |
| InChIKey | VICSLOHTZDWOFF-QGZVFWFLSA-N |
| SMILES | C[C@H](CC1=CC(=C2C(=C1)C=CN2CCCO)C(=O)N)NCCOC3=CC=CC=C3OCC(F)(F)F |
Computed by PubChem (NCBI)