CAS 17589-24-1 is the registry number for 1,3-Bis(4-(4-Isocyanatobenzyl)phenyl)-1,3-Diazetidine-2,4-Dione. Offered by: Chemat Brand. Available pack sizes: on request.
1,3-bis[4-[(4-isocyanatophenyl)methyl]phenyl]-1,3-diazetidine-2,4-dione (CAS 17589-24-1) is a chemical compound with the molecular formula C30H20N4O4 and a molecular weight of 500.5 g/mol. IUPAC name: 1,3-bis[4-[(4-isocyanatophenyl)methyl]phenyl]-1,3-diazetidine-2,4-dione. InChIKey: ARRNPOPZVLSDGB-UHFFFAOYSA-N.
| Molecular formula | C30H20N4O4 |
|---|---|
| Molecular weight | 500.5 g/mol |
| IUPAC name | 1,3-bis[4-[(4-isocyanatophenyl)methyl]phenyl]-1,3-diazetidine-2,4-dione |
| InChIKey | ARRNPOPZVLSDGB-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1CC2=CC=C(C=C2)N3C(=O)N(C3=O)C4=CC=C(C=C4)CC5=CC=C(C=C5)N=C=O)N=C=O |
Computed by PubChem (NCBI)