Products 175897-66-2
CAS 175897-66-2 appears in our catalog under these names: 2-Hydroxy-3-(4-methylphenyl)propanoic acid, 2-Hydroxy-3-(p-tolyl)propanoic acid 95%. Offered by: Biosynth, Ambeed. Available pack sizes: 50mg, 0,5g, 25mg, 100mg, 250mg, 1g.
2-hydroxy-3-(4-methylphenyl)propanoic acid (CAS 175897-66-2) is a chemical compound with the molecular formula C10H12O3 and a molecular weight of 180.20 g/mol. IUPAC name: 2-hydroxy-3-(4-methylphenyl)propanoic acid. InChIKey: IIAHPWWDVIUNBP-UHFFFAOYSA-N.
| Molecular formula | C10H12O3 |
|---|---|
| Molecular weight | 180.20 g/mol |
| IUPAC name | 2-hydroxy-3-(4-methylphenyl)propanoic acid |
| InChIKey | IIAHPWWDVIUNBP-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)CC(C(=O)O)O |
Computed by PubChem (NCBI)