Products 175909-91-8

CAS 175909-91-8 is the registry number for Ethyl 6-sulfanylpyridine-3-carboxylate. Offered by: Biosynth. Available pack sizes: 250mg, 2,5g.

Structural formula: {0} (CAS {1})

Ethyl 6-sulfanylidene-1H-pyridine-3-carboxylate (CAS 175909-91-8) is a chemical compound with the molecular formula C8H9NO2S and a molecular weight of 183.23 g/mol. IUPAC name: ethyl 6-sulfanylidene-1H-pyridine-3-carboxylate. InChIKey: CKUOYKJEONNLOF-UHFFFAOYSA-N.

Identity
Molecular formulaC8H9NO2S
Molecular weight183.23 g/mol
IUPAC nameethyl 6-sulfanylidene-1H-pyridine-3-carboxylate
InChIKeyCKUOYKJEONNLOF-UHFFFAOYSA-N
SMILESCCOC(=O)C1=CNC(=S)C=C1

Computed by PubChem (NCBI)