CAS 17594-47-7 appears in our catalog under these names: Barium (2,2,6,6-tetramethyl-3,5-heptanedionate) tetramer, 95%, Bis(dipivaloylmethanato)barium(II), Barium-thd/ 99.99%, Barium-thd, 99.99%, Barium 2,2,6,6-tetramethyl-5-oxohept-3-en-3-olate 97%. Offered by: Combi-blocks, GLPBio, Chemat, Ambeed. Available pack sizes: 1g, 5g, 10g, 250mg.
Barium(2+);bis((Z)-2,2,6,6-tetramethyl-5-oxohept-3-en-3-olate) (CAS 17594-47-7) is a chemical compound with the molecular formula C22H38BaO4 and a molecular weight of 503.9 g/mol. IUPAC name: barium(2+);bis((Z)-2,2,6,6-tetramethyl-5-oxohept-3-en-3-olate). InChIKey: NYBMVAOYALBBBH-ATMONBRVSA-L.
| Molecular formula | C22H38BaO4 |
|---|---|
| Molecular weight | 503.9 g/mol |
| IUPAC name | barium(2+);bis((Z)-2,2,6,6-tetramethyl-5-oxohept-3-en-3-olate) |
| InChIKey | NYBMVAOYALBBBH-ATMONBRVSA-L |
| SMILES | CC(/C(=C/C(=O)C(C)(C)C)/[O-])(C)C.CC(/C(=C/C(=O)C(C)(C)C)/[O-])(C)C.[Ba+2] |
Computed by PubChem (NCBI)