CAS 17596-06-4 is the registry number for Tartrazine Impurity 2 Monomer. Offered by: Hubei YoungXin. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg.
4-[2-(4-sulfophenyl)iminohydrazinyl]benzenesulfonic acid (CAS 17596-06-4) is a chemical compound with the molecular formula C12H11N3O6S2 and a molecular weight of 357.4 g/mol. IUPAC name: 4-[2-(4-sulfophenyl)iminohydrazinyl]benzenesulfonic acid. InChIKey: AJMWXYSMAMYAIT-UHFFFAOYSA-N.
| Molecular formula | C12H11N3O6S2 |
|---|---|
| Molecular weight | 357.4 g/mol |
| IUPAC name | 4-[2-(4-sulfophenyl)iminohydrazinyl]benzenesulfonic acid |
| InChIKey | AJMWXYSMAMYAIT-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1NN=NC2=CC=C(C=C2)S(=O)(=O)O)S(=O)(=O)O |
Computed by PubChem (NCBI)