Products 17596-06-4

CAS 17596-06-4 is the registry number for Tartrazine Impurity 2 Monomer. Offered by: Hubei YoungXin. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg.

Structural formula: {0} (CAS {1})

4-[2-(4-sulfophenyl)iminohydrazinyl]benzenesulfonic acid (CAS 17596-06-4) is a chemical compound with the molecular formula C12H11N3O6S2 and a molecular weight of 357.4 g/mol. IUPAC name: 4-[2-(4-sulfophenyl)iminohydrazinyl]benzenesulfonic acid. InChIKey: AJMWXYSMAMYAIT-UHFFFAOYSA-N.

Identity
Molecular formulaC12H11N3O6S2
Molecular weight357.4 g/mol
IUPAC name4-[2-(4-sulfophenyl)iminohydrazinyl]benzenesulfonic acid
InChIKeyAJMWXYSMAMYAIT-UHFFFAOYSA-N
SMILESC1=CC(=CC=C1NN=NC2=CC=C(C=C2)S(=O)(=O)O)S(=O)(=O)O

Computed by PubChem (NCBI)