CAS 17599-61-0 appears in our catalog under these names: N-Trimethylsilylbenzaldimine, 95%, N–Trimethylsilylbenzaldimine. Offered by: Combi-blocks, GLPBio, Sigma-Aldrich. Available pack sizes: 5g, 25g.
1-phenyl-N-trimethylsilylmethanimine (CAS 17599-61-0) is a chemical compound with the molecular formula C10H15NSi and a molecular weight of 177.32 g/mol. IUPAC name: 1-phenyl-N-trimethylsilylmethanimine. InChIKey: ATGAAABKKYCMRZ-UHFFFAOYSA-N.
| Molecular formula | C10H15NSi |
|---|---|
| Molecular weight | 177.32 g/mol |
| IUPAC name | 1-phenyl-N-trimethylsilylmethanimine |
| InChIKey | ATGAAABKKYCMRZ-UHFFFAOYSA-N |
| SMILES | C[Si](C)(C)N=CC1=CC=CC=C1 |
Computed by PubChem (NCBI)