CAS 176022-03-0 appears in our catalog under these names: Paroxetine Impurity 7, Paroxetine Impurity 8, ((3S,4R)–4–Phenyl–1–methylpiperidinyl)methanol. Offered by: Chemat Brand, Hubei YoungXin, GLPBio. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg, 1g.
[(3S,4R)-1-methyl-4-phenylpiperidin-3-yl]methanol (CAS 176022-03-0) is a chemical compound with the molecular formula C13H19NO and a molecular weight of 205.30 g/mol. IUPAC name: [(3S,4R)-1-methyl-4-phenylpiperidin-3-yl]methanol. InChIKey: PTRITADCAOWGKC-STQMWFEESA-N.
| Molecular formula | C13H19NO |
|---|---|
| Molecular weight | 205.30 g/mol |
| IUPAC name | [(3S,4R)-1-methyl-4-phenylpiperidin-3-yl]methanol |
| InChIKey | PTRITADCAOWGKC-STQMWFEESA-N |
| SMILES | CN1CC[C@H]([C@@H](C1)CO)C2=CC=CC=C2 |
Computed by PubChem (NCBI)